RBE No. 151/2008: Family Planning Allowance
No.PC-VI/2008/A/O/2/(FPA), dated 14.10.2008
S.No.PC-VI/34
Sub: Revision in the rates of Family Planning Allowance for adoption of small family norms following the recommendations of the Sixth Central Pay Commission.
1. Consequent upon the implementation of the revised pay structure by the Government with effect from 1st January, 2006 on the basis of recommendations of the Sixth Central Pay Commission and in partial modification of Board’s letter No.PC-V/99/I/7/6/2, dated 21.07.1999 (RBE No. 180/1999) the President is pleased to sanction the revised Family Planning Allowance at double the existing amount of the Family Planning Allowance, subject to minimum of Rs.210 per month as indicated in Column 7 of Annexure to this order.
2. The allowance will be related to the Grade Pay corresponding to the post against which the employee concerned had initially earned or will earn the Family Planning Allowance. All other terms and conditions governing the grant of Family Planning Allowance shall remain unchanged.
3. These orders will be effective from 1st September, 2008.
4. This issues with the concurrence of the Finance Directorate of the Ministry of Railways.
5. Hindi version is enclosed.
ANNEXURE
|
Sl. No. |
Post/ Grade |
Present Scale |
Name of Pay Band/ Scale |
Corresponding Pay Bands/ Scales |
Corresponding Grade Pay |
Rate of Family Planning Allowance |
|
(1) |
(2) |
(3) |
(4) |
(5) |
(6) |
(7) |
|
1 |
S-1 |
2550-55-2660-60-3200 |
-1S |
4440-7440 |
1300 |
210 |
|
2 |
S-2 |
2610-60-3150-65-3540 |
-1S |
4440-7440 |
1400 |
|
|
3 |
S-2A |
2610-60-2910-65-3300-70-4000 |
-1S |
4440-7440 |
1600 |
|
|
4 |
S-3 |
2650-65-3300-70-4000 |
-1S |
4440-7440 |
1650 |
|
|
5 |
S-4 |
2750-70-3800-75-4400 |
PB-1 |
5200-20200 |
1800 |
|
|
6 |
S-5 |
3050-75-3950-80-4590 |
PB-1 |
5200-20200 |
1900 |
|
|
7 |
S-6 |
3200-85-4900 |
PB-1 |
5200-20200 |
2000 |
|
|
8 |
S-7 |
4000-100-6000 |
PB-1 |
5200-20200 |
2400 |
|
|
9 |
S-8 |
4500-125-7000 |
PB-1 |
5200-20200 |
2800 |
250 |
|
10 |
S-9 |
5000-150-8000 |
PB-2 |
9300-34800 |
4200 |
400 |
|
11 |
S-10 |
5500-175-9000 |
PB-2 |
9300-34800 |
4200 |
|
|
12 |
S-10A |
6000-190-9800 |
PB-2 |
9300-34800 |
4200 |
|
|
13 |
S-11 |
6500-200-6900 |
PB-2 |
9300-34800 |
4200 |
|
|
14 |
S-12 |
6500-200-10500 |
PB-2 |
9300-34800 |
4200 |
|
|
15 |
S-13 |
7450-225-11500 |
PB-2 |
9300-34800 |
4600 |
450 |
|
16 |
S-14 |
7500-250-12000 |
PB-2 |
9300-34800 |
4800 |
500 |
|
17 |
S-15 |
8000-275-13500 |
PB-2 |
9300-34800 |
5400 |
550 |
|
18 |
New Scale |
8000-275-13500 (Group ‘A’ Entry) |
PB-3 |
15600-39100 |
5400 |
|
|
19 |
S-16 |
9000 |
PB-3 |
15600-39100 |
5400 |
|
|
20 |
S-17 |
9000-275-9550 |
PB-3 |
15600-39100 |
5400 |
|
|
21 |
S-18 |
10325-325-10975 |
PB-3 |
15600-39100 |
6600 |
650 |
|
22 |
S-19 |
10000-325-15200 |
PB-3 |
15600-39100 |
6600 |
|
|
23 |
S-20 |
10650-325-15850 |
PB-3 |
15600-39100 |
6600 |
|
|
24 |
S-21 |
12000-375-16500 |
PB-3 |
15600-39100 |
7600 |
750 |
|
25 |
S-22 |
12750-375-16500 |
PB-3 |
15600-39100 |
7600 |
|
|
26 |
S-23 |
12000-375-18000 |
PB-3 |
15600-39100 |
7600 |
|
|
27 |
S-24 |
14300-400-18300 |
PB-4 |
37400-67000 |
8700 |
800 |
|
28 |
S-25 |
15100-400-18300 |
PB-4 |
37400-67000 |
8700 |
|
|
29 |
S-26 |
16400-450-20000 |
PB-4 |
37400-67000 |
8900 |
900 |
|
30 |
S-27 |
16400-450-20900 |
PB-4 |
37400-67000 |
8900 |
|
|
31 |
S-28 |
14300-450-22400 |
PB-4 |
37400-67000 |
10000 |
1000 |
|
32 |
S-29 |
18400-500-22400 |
PB-4 |
37400-67000 |
10000 |
Download Railway Board Circular RBE No. 151/2008
Forward reference ⇒ RBE No.